C15H28O2 — CID 173128843
5,5-dimethyltridecane-2,7-dione (PubChem CID 173128843) has the molecular formula C15H28O2 and a molecular weight of 240.39 g/mol. Its IUPAC name is 5,5-dimethyltridecane-2,7-dione.
| Compound Name | 5,5-dimethyltridecane-2,7-dione |
|---|---|
| PubChem CID | 173128843 |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.21 |
| IUPAC Name | 5,5-dimethyltridecane-2,7-dione |
| SMILES | CCCCCCC(=O)CC(C)(C)CCC(C)=O |
| InChI | InChI=1S/C15H28O2/c1-5-6-7-8-9-14(17)12-15(3,4)11-10-13(2)16/h5-12H2,1-4H3 |
| InChIKey | SHQRYXHHUFQXEN-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|