C28H52B4O8 — CID 101193904
4,4,5,5-tetramethyl-2-[(E)-1,3,4-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-en-2-yl]-1,3,2-dioxaborolane (PubChem CID 101193904) has the molecular formula C28H52B4O8 and a molecular weight of 559.96 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[(E)-1,3,4-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-en-2-yl]-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[(E)-1,3,4-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-en-2-yl]-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 101193904 |
| Molecular Formula | C28H52B4O8 |
| Molecular Weight | 559.96 g/mol |
| Exact Mass | 560.40 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[(E)-1,3,4-tris(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)but-2-en-2-yl]-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(C/C(B2OC(C)(C)C(C)(C)O2)=C(/CB2OC(C)(C)C(C)(C)O2)B2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C28H52B4O8/c1-21(2)22(3,4)34-29(33-21)17-19(31-37-25(9,10)26(11,12)38-31)20(32-39-27(13,14)28(15,16)40-32)18-30-35-23(5,6)24(7,8)36-30/h17-18H2,1-16H3/b20-19+ |
| InChIKey | BYKWWBLVZCRBKE-FMQUCBEESA-N |
| XLogP | 5.73 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.96 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|