C15H19NO2 — CID 101198196
(1R,10bS)-1-butyl-1,5,6,10b-tetrahydro-[1,2]oxazolo[3,2-a]isoquinolin-2-one (PubChem CID 101198196) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is (1R,10bS)-1-butyl-1,5,6,10b-tetrahydro-[1,2]oxazolo[3,2-a]isoquinolin-2-one.
| Compound Name | (1R,10bS)-1-butyl-1,5,6,10b-tetrahydro-[1,2]oxazolo[3,2-a]isoquinolin-2-one |
|---|---|
| PubChem CID | 101198196 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | (1R,10bS)-1-butyl-1,5,6,10b-tetrahydro-[1,2]oxazolo[3,2-a]isoquinolin-2-one |
| SMILES | CCCC[C@H]1C(=O)ON2CCc3ccccc3[C@H]12 |
| InChI | InChI=1S/C15H19NO2/c1-2-3-7-13-14-12-8-5-4-6-11(12)9-10-16(14)18-15(13)17/h4-6,8,13-14H,2-3,7,9-10H2,1H3/t13-,14-/m1/s1 |
| InChIKey | LCOQLSNVBMIQQC-ZIAGYGMSSA-N |
| XLogP | 2.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |