C15H19NSi — CID 11831582
2-[(1S,8bR)-1,3,4,8b-tetrahydroazirino[2,1-a]isoquinolin-1-yl]ethynyl-trimethylsilane (PubChem CID 11831582) has the molecular formula C15H19NSi and a molecular weight of 241.41 g/mol. Its IUPAC name is 2-[(1S,8bR)-1,3,4,8b-tetrahydroazirino[2,1-a]isoquinolin-1-yl]ethynyl-trimethylsilane.
| Compound Name | 2-[(1S,8bR)-1,3,4,8b-tetrahydroazirino[2,1-a]isoquinolin-1-yl]ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 11831582 |
| Molecular Formula | C15H19NSi |
| Molecular Weight | 241.41 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 2-[(1S,8bR)-1,3,4,8b-tetrahydroazirino[2,1-a]isoquinolin-1-yl]ethynyl-trimethylsilane |
| SMILES | C[Si](C)(C)C#C[C@H]1[C@H]2c3ccccc3CCN21 |
| InChI | InChI=1S/C15H19NSi/c1-17(2,3)11-9-14-15-13-7-5-4-6-12(13)8-10-16(14)15/h4-7,14-15H,8,10H2,1-3H3/t14-,15+,16?/m0/s1 |
| InChIKey | KNDUCZFXKHKXME-QMRHZFGWSA-N |
| XLogP | 2.85 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.41 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|