C20H23NO6 — CID 101201662
(2S,3S,4R,5R)-2-methoxy-5-(nitromethyl)-3,4-bis(phenylmethoxy)oxolane (PubChem CID 101201662) has the molecular formula C20H23NO6 and a molecular weight of 373.41 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-methoxy-5-(nitromethyl)-3,4-bis(phenylmethoxy)oxolane.
| Compound Name | (2S,3S,4R,5R)-2-methoxy-5-(nitromethyl)-3,4-bis(phenylmethoxy)oxolane |
|---|---|
| PubChem CID | 101201662 |
| Molecular Formula | C20H23NO6 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.15 |
| IUPAC Name | (2S,3S,4R,5R)-2-methoxy-5-(nitromethyl)-3,4-bis(phenylmethoxy)oxolane |
| SMILES | CO[C@H]1O[C@H](C[N+](=O)[O-])[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C20H23NO6/c1-24-20-19(26-14-16-10-6-3-7-11-16)18(17(27-20)12-21(22)23)25-13-15-8-4-2-5-9-15/h2-11,17-20H,12-14H2,1H3/t17-,18-,19+,20+/m1/s1 |
| InChIKey | IWEYVRPZPDZIPD-ZRNYENFQSA-N |
| XLogP | 2.81 |
| TPSA | 80.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|