C13H17NO7 — CID 11220274
(2R,3S,4S,5R)-5-(nitromethyl)-2-phenylmethoxyoxane-3,4,5-triol (PubChem CID 11220274) has the molecular formula C13H17NO7 and a molecular weight of 299.28 g/mol. Its IUPAC name is (2R,3S,4S,5R)-5-(nitromethyl)-2-phenylmethoxyoxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R)-5-(nitromethyl)-2-phenylmethoxyoxane-3,4,5-triol |
|---|---|
| PubChem CID | 11220274 |
| Molecular Formula | C13H17NO7 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | (2R,3S,4S,5R)-5-(nitromethyl)-2-phenylmethoxyoxane-3,4,5-triol |
| SMILES | O=[N+]([O-])C[C@@]1(O)CO[C@@H](OCc2ccccc2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C13H17NO7/c15-10-11(16)13(17,7-14(18)19)8-21-12(10)20-6-9-4-2-1-3-5-9/h1-5,10-12,15-17H,6-8H2/t10-,11-,12+,13+/m0/s1 |
| InChIKey | MCEJVWPYHIIEJJ-WUHRBBMRSA-N |
| XLogP | -0.71 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|