C23H36O3 — CID 101203793
(2R,3S,6R)-2-[(Z)-hept-3-enyl]-6-[(2-methylpropan-2-yl)oxy]-3-phenylmethoxyoxane (PubChem CID 101203793) has the molecular formula C23H36O3 and a molecular weight of 360.54 g/mol. Its IUPAC name is (2R,3S,6R)-2-[(Z)-hept-3-enyl]-6-[(2-methylpropan-2-yl)oxy]-3-phenylmethoxyoxane.
| Compound Name | (2R,3S,6R)-2-[(Z)-hept-3-enyl]-6-[(2-methylpropan-2-yl)oxy]-3-phenylmethoxyoxane |
|---|---|
| PubChem CID | 101203793 |
| Molecular Formula | C23H36O3 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.27 |
| IUPAC Name | (2R,3S,6R)-2-[(Z)-hept-3-enyl]-6-[(2-methylpropan-2-yl)oxy]-3-phenylmethoxyoxane |
| SMILES | CCC/C=C\CC[C@H]1O[C@H](OC(C)(C)C)CC[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C23H36O3/c1-5-6-7-8-12-15-21-20(24-18-19-13-10-9-11-14-19)16-17-22(25-21)26-23(2,3)4/h7-11,13-14,20-22H,5-6,12,15-18H2,1-4H3/b8-7-/t20-,21+,22+/m0/s1 |
| InChIKey | WXITURSIZVQICH-GGWMRMRCSA-N |
| XLogP | 6.03 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|