C21H33NO2Si — CID 101212303
(3S,5R)-1-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-5-prop-2-enylpyrrolidin-2-one (PubChem CID 101212303) has the molecular formula C21H33NO2Si and a molecular weight of 359.59 g/mol. Its IUPAC name is (3S,5R)-1-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-5-prop-2-enylpyrrolidin-2-one.
| Compound Name | (3S,5R)-1-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-5-prop-2-enylpyrrolidin-2-one |
|---|---|
| PubChem CID | 101212303 |
| Molecular Formula | C21H33NO2Si |
| Molecular Weight | 359.59 g/mol |
| Exact Mass | 359.23 |
| IUPAC Name | (3S,5R)-1-benzyl-3-[tert-butyl(dimethyl)silyl]oxy-5-methyl-5-prop-2-enylpyrrolidin-2-one |
| SMILES | C=CC[C@]1(C)C[C@H](O[Si](C)(C)C(C)(C)C)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H33NO2Si/c1-8-14-21(5)15-18(24-25(6,7)20(2,3)4)19(23)22(21)16-17-12-10-9-11-13-17/h8-13,18H,1,14-16H2,2-7H3/t18-,21+/m0/s1 |
| InChIKey | VAMWOEZDUJGTFG-GHTZIAJQSA-N |
| XLogP | 5.14 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.59 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|