C45H50N4O5 — CID 101212582
N,N-bis(4-butoxyphenyl)-4-[(E)-5-[2,5-dimethyl-4-[(4-nitrophenyl)diazenyl]phenoxy]pent-1-enyl]aniline (PubChem CID 101212582) has the molecular formula C45H50N4O5 and a molecular weight of 726.92 g/mol. Its IUPAC name is N,N-bis(4-butoxyphenyl)-4-[(E)-5-[2,5-dimethyl-4-[(4-nitrophenyl)diazenyl]phenoxy]pent-1-enyl]aniline.
| Compound Name | N,N-bis(4-butoxyphenyl)-4-[(E)-5-[2,5-dimethyl-4-[(4-nitrophenyl)diazenyl]phenoxy]pent-1-enyl]aniline |
|---|---|
| PubChem CID | 101212582 |
| Molecular Formula | C45H50N4O5 |
| Molecular Weight | 726.92 g/mol |
| Exact Mass | 726.38 |
| IUPAC Name | N,N-bis(4-butoxyphenyl)-4-[(E)-5-[2,5-dimethyl-4-[(4-nitrophenyl)diazenyl]phenoxy]pent-1-enyl]aniline |
| SMILES | CCCCOc1ccc(N(c2ccc(/C=C/CCCOc3cc(C)c(/N=N/c4ccc([N+](=O)[O-])cc4)cc3C)cc2)c2ccc(OCCCC)cc2)cc1 |
| InChI | InChI=1S/C45H50N4O5/c1-5-7-29-52-42-25-21-39(22-26-42)48(40-23-27-43(28-24-40)53-30-8-6-2)38-17-13-36(14-18-38)12-10-9-11-31-54-45-33-34(3)44(32-35(45)4)47-46-37-15-19-41(20-16-37)49(50)51/h10,12-28,32-33H,5-9,11,29-31H2,1-4H3/b12-10+,47-46+ |
| InChIKey | FXQXYHQVEOVMJW-UTPRFXJGSA-N |
| XLogP | 13.33 |
| TPSA | 98.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.92 |
| LogP ≤ 5 | 13.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|