C33H38O4 — CID 101216816
[3-methyl-4-[(2S)-2-methylbutanoyl]phenyl] 4-(4-oct-7-enoxyphenyl)benzoate (PubChem CID 101216816) has the molecular formula C33H38O4 and a molecular weight of 498.66 g/mol. Its IUPAC name is [3-methyl-4-[(2S)-2-methylbutanoyl]phenyl] 4-(4-oct-7-enoxyphenyl)benzoate.
| Compound Name | [3-methyl-4-[(2S)-2-methylbutanoyl]phenyl] 4-(4-oct-7-enoxyphenyl)benzoate |
|---|---|
| PubChem CID | 101216816 |
| Molecular Formula | C33H38O4 |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.28 |
| IUPAC Name | [3-methyl-4-[(2S)-2-methylbutanoyl]phenyl] 4-(4-oct-7-enoxyphenyl)benzoate |
| SMILES | C=CCCCCCCOc1ccc(-c2ccc(C(=O)Oc3ccc(C(=O)[C@@H](C)CC)c(C)c3)cc2)cc1 |
| InChI | InChI=1S/C33H38O4/c1-5-7-8-9-10-11-22-36-29-18-16-27(17-19-29)26-12-14-28(15-13-26)33(35)37-30-20-21-31(25(4)23-30)32(34)24(3)6-2/h5,12-21,23-24H,1,6-11,22H2,2-4H3/t24-/m0/s1 |
| InChIKey | MIDVMLNBEIQALF-DEOSSOPVSA-N |
| XLogP | 8.63 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 8.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|