C22H36O3S2Si — CID 101218636
tert-butyl-[[(2R,4S,5R)-4-[2-(1,3-dithian-2-yl)ethyl]-2-phenyl-1,3-dioxan-5-yl]oxy]-dimethylsilane (PubChem CID 101218636) has the molecular formula C22H36O3S2Si and a molecular weight of 440.75 g/mol. Its IUPAC name is tert-butyl-[[(2R,4S,5R)-4-[2-(1,3-dithian-2-yl)ethyl]-2-phenyl-1,3-dioxan-5-yl]oxy]-dimethylsilane.
| Compound Name | tert-butyl-[[(2R,4S,5R)-4-[2-(1,3-dithian-2-yl)ethyl]-2-phenyl-1,3-dioxan-5-yl]oxy]-dimethylsilane |
|---|---|
| PubChem CID | 101218636 |
| Molecular Formula | C22H36O3S2Si |
| Molecular Weight | 440.75 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | tert-butyl-[[(2R,4S,5R)-4-[2-(1,3-dithian-2-yl)ethyl]-2-phenyl-1,3-dioxan-5-yl]oxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CO[C@@H](c2ccccc2)O[C@H]1CCC1SCCCS1 |
| InChI | InChI=1S/C22H36O3S2Si/c1-22(2,3)28(4,5)25-19-16-23-21(17-10-7-6-8-11-17)24-18(19)12-13-20-26-14-9-15-27-20/h6-8,10-11,18-21H,9,12-16H2,1-5H3/t18-,19+,21+/m0/s1 |
| InChIKey | PZXOSWNTXHPJCC-QKNQBKEWSA-N |
| XLogP | 6.47 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.75 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|