C13H16Cl2O4 — CID 101220785
[(1S,2S,5S)-6,7-dichloro-3,4-dioxo-2-bicyclo[3.2.0]heptanyl]methyl 2,2-dimethylpropanoate (PubChem CID 101220785) has the molecular formula C13H16Cl2O4 and a molecular weight of 307.17 g/mol. Its IUPAC name is [(1S,2S,5S)-6,7-dichloro-3,4-dioxo-2-bicyclo[3.2.0]heptanyl]methyl 2,2-dimethylpropanoate.
| Compound Name | [(1S,2S,5S)-6,7-dichloro-3,4-dioxo-2-bicyclo[3.2.0]heptanyl]methyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 101220785 |
| Molecular Formula | C13H16Cl2O4 |
| Molecular Weight | 307.17 g/mol |
| Exact Mass | 306.04 |
| IUPAC Name | [(1S,2S,5S)-6,7-dichloro-3,4-dioxo-2-bicyclo[3.2.0]heptanyl]methyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OC[C@H]1C(=O)C(=O)[C@H]2C(Cl)C(Cl)[C@@H]12 |
| InChI | InChI=1S/C13H16Cl2O4/c1-13(2,3)12(18)19-4-5-6-7(9(15)8(6)14)11(17)10(5)16/h5-9H,4H2,1-3H3/t5-,6+,7-,8?,9?/m1/s1 |
| InChIKey | FSSUTGLPIDKRNT-YOOJIQPZSA-N |
| XLogP | 1.80 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.17 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|