C19H14F2O3 — CID 101221197
2,3-difluoro-8-methoxy-5,6-dihydrochrysene-1,4-diol (PubChem CID 101221197) has the molecular formula C19H14F2O3 and a molecular weight of 328.31 g/mol. Its IUPAC name is 2,3-difluoro-8-methoxy-5,6-dihydrochrysene-1,4-diol.
| Compound Name | 2,3-difluoro-8-methoxy-5,6-dihydrochrysene-1,4-diol |
|---|---|
| PubChem CID | 101221197 |
| Molecular Formula | C19H14F2O3 |
| Molecular Weight | 328.31 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 2,3-difluoro-8-methoxy-5,6-dihydrochrysene-1,4-diol |
| SMILES | COc1ccc2c(c1)CCc1c-2ccc2c(O)c(F)c(F)c(O)c12 |
| InChI | InChI=1S/C19H14F2O3/c1-24-10-3-5-11-9(8-10)2-4-13-12(11)6-7-14-15(13)19(23)17(21)16(20)18(14)22/h3,5-8,22-23H,2,4H2,1H3 |
| InChIKey | WZDLVIDVMGKKQX-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.31 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|