C38H30O8S — CID 10122282
4-[4-(2-butyl-1-benzofuran-3-carbonyl)-2,6-diphenylphenoxy]sulfonyl-2-hydroxybenzoic acid (PubChem CID 10122282) has the molecular formula C38H30O8S and a molecular weight of 646.72 g/mol. Its IUPAC name is 4-[4-(2-butyl-1-benzofuran-3-carbonyl)-2,6-diphenylphenoxy]sulfonyl-2-hydroxybenzoic acid.
| Compound Name | 4-[4-(2-butyl-1-benzofuran-3-carbonyl)-2,6-diphenylphenoxy]sulfonyl-2-hydroxybenzoic acid |
|---|---|
| PubChem CID | 10122282 |
| Molecular Formula | C38H30O8S |
| Molecular Weight | 646.72 g/mol |
| Exact Mass | 646.17 |
| IUPAC Name | 4-[4-(2-butyl-1-benzofuran-3-carbonyl)-2,6-diphenylphenoxy]sulfonyl-2-hydroxybenzoic acid |
| SMILES | CCCCc1oc2ccccc2c1C(=O)c1cc(-c2ccccc2)c(OS(=O)(=O)c2ccc(C(=O)O)c(O)c2)c(-c2ccccc2)c1 |
| InChI | InChI=1S/C38H30O8S/c1-2-3-17-34-35(29-16-10-11-18-33(29)45-34)36(40)26-21-30(24-12-6-4-7-13-24)37(31(22-26)25-14-8-5-9-15-25)46-47(43,44)27-19-20-28(38(41)42)32(39)23-27/h4-16,18-23,39H,2-3,17H2,1H3,(H,41,42) |
| InChIKey | ROWUYPKIXLXIOO-UHFFFAOYSA-N |
| XLogP | 8.51 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.72 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|