C32H52N2O2Si2 — CID 101225453
[2-[(2S,3S,4aR,8aR)-3-[2-[tert-butyl(dimethyl)silyl]oxyphenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxalin-2-yl]phenoxy]-tert-butyl-dimethylsilane (PubChem CID 101225453) has the molecular formula C32H52N2O2Si2 and a molecular weight of 552.95 g/mol. Its IUPAC name is [2-[(2S,3S,4aR,8aR)-3-[2-[tert-butyl(dimethyl)silyl]oxyphenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxalin-2-yl]phenoxy]-tert-butyl-dimethylsilane.
| Compound Name | [2-[(2S,3S,4aR,8aR)-3-[2-[tert-butyl(dimethyl)silyl]oxyphenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxalin-2-yl]phenoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 101225453 |
| Molecular Formula | C32H52N2O2Si2 |
| Molecular Weight | 552.95 g/mol |
| Exact Mass | 552.36 |
| IUPAC Name | [2-[(2S,3S,4aR,8aR)-3-[2-[tert-butyl(dimethyl)silyl]oxyphenyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroquinoxalin-2-yl]phenoxy]-tert-butyl-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccccc1[C@@H]1N[C@@H]2CCCC[C@H]2N[C@H]1c1ccccc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H52N2O2Si2/c1-31(2,3)37(7,8)35-27-21-15-11-17-23(27)29-30(34-26-20-14-13-19-25(26)33-29)24-18-12-16-22-28(24)36-38(9,10)32(4,5)6/h11-12,15-18,21-22,25-26,29-30,33-34H,13-14,19-20H2,1-10H3/t25-,26-,29+,30+/m1/s1 |
| InChIKey | GFBKUPLQILBPMO-HHGOQMMWSA-N |
| XLogP | 8.74 |
| TPSA | 42.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.95 |
| LogP ≤ 5 | 8.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|