C23H29N2OP — CID 101227018
[(2S)-2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]-diphenylphosphane (PubChem CID 101227018) has the molecular formula C23H29N2OP and a molecular weight of 380.47 g/mol. Its IUPAC name is [(2S)-2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]-diphenylphosphane.
| Compound Name | [(2S)-2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]-diphenylphosphane |
|---|---|
| PubChem CID | 101227018 |
| Molecular Formula | C23H29N2OP |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | [(2S)-2-[(4R)-4-tert-butyl-4,5-dihydro-1,3-oxazol-2-yl]pyrrolidin-1-yl]-diphenylphosphane |
| SMILES | CC(C)(C)[C@@H]1COC([C@@H]2CCCN2P(c2ccccc2)c2ccccc2)=N1 |
| InChI | InChI=1S/C23H29N2OP/c1-23(2,3)21-17-26-22(24-21)20-15-10-16-25(20)27(18-11-6-4-7-12-18)19-13-8-5-9-14-19/h4-9,11-14,20-21H,10,15-17H2,1-3H3/t20-,21-/m0/s1 |
| InChIKey | OVXWZUJBTHTJQR-SFTDATJTSA-N |
| XLogP | 4.34 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|