C13H20N4O7 — CID 101239648
5-(3-oxobutan-2-ylideneamino)-6-[[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]-1H-pyrimidine-2,4-dione (PubChem CID 101239648) has the molecular formula C13H20N4O7 and a molecular weight of 344.32 g/mol. Its IUPAC name is 5-(3-oxobutan-2-ylideneamino)-6-[[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]-1H-pyrimidine-2,4-dione.
| Compound Name | 5-(3-oxobutan-2-ylideneamino)-6-[[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 101239648 |
| Molecular Formula | C13H20N4O7 |
| Molecular Weight | 344.32 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 5-(3-oxobutan-2-ylideneamino)-6-[[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]-1H-pyrimidine-2,4-dione |
| SMILES | CC(=O)/C(C)=N/c1c(NC[C@H](O)[C@H](O)[C@H](O)CO)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H20N4O7/c1-5(6(2)19)15-9-11(16-13(24)17-12(9)23)14-3-7(20)10(22)8(21)4-18/h7-8,10,18,20-22H,3-4H2,1-2H3,(H3,14,16,17,23,24)/b15-5+/t7-,8+,10-/m0/s1 |
| InChIKey | IQUNWCXHRPDMBI-MMRHRDNQSA-N |
| XLogP | -2.77 |
| TPSA | 188.10 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.32 |
| LogP ≤ 5 | -2.77 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|