C13H24N3O9P — CID 10596932
4-[2,4-dioxo-6-[[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]-1H-pyrimidin-5-yl]butylphosphonic acid (PubChem CID 10596932) has the molecular formula C13H24N3O9P and a molecular weight of 397.32 g/mol. Its IUPAC name is 4-[2,4-dioxo-6-[[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]-1H-pyrimidin-5-yl]butylphosphonic acid.
| Compound Name | 4-[2,4-dioxo-6-[[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]-1H-pyrimidin-5-yl]butylphosphonic acid |
|---|---|
| PubChem CID | 10596932 |
| Molecular Formula | C13H24N3O9P |
| Molecular Weight | 397.32 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | 4-[2,4-dioxo-6-[[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]-1H-pyrimidin-5-yl]butylphosphonic acid |
| SMILES | O=c1[nH]c(NC[C@H](O)[C@H](O)[C@H](O)CO)c(CCCCP(=O)(O)O)c(=O)[nH]1 |
| InChI | InChI=1S/C13H24N3O9P/c17-6-9(19)10(20)8(18)5-14-11-7(12(21)16-13(22)15-11)3-1-2-4-26(23,24)25/h8-10,17-20H,1-6H2,(H2,23,24,25)(H3,14,15,16,21,22)/t8-,9+,10-/m0/s1 |
| InChIKey | SLSTYUSPJRHORA-AEJSXWLSSA-N |
| XLogP | -2.95 |
| TPSA | 216.20 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.32 |
| LogP ≤ 5 | -2.95 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|