C12H20N4O8 — CID 118156803
2-[[2,4-dioxo-6-[[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]-1H-pyrimidin-5-yl]amino]propanoic acid (PubChem CID 118156803) has the molecular formula C12H20N4O8 and a molecular weight of 348.31 g/mol. Its IUPAC name is 2-[[2,4-dioxo-6-[[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]-1H-pyrimidin-5-yl]amino]propanoic acid.
| Compound Name | 2-[[2,4-dioxo-6-[[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]-1H-pyrimidin-5-yl]amino]propanoic acid |
|---|---|
| PubChem CID | 118156803 |
| Molecular Formula | C12H20N4O8 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 2-[[2,4-dioxo-6-[[(2S,3S,4R)-2,3,4,5-tetrahydroxypentyl]amino]-1H-pyrimidin-5-yl]amino]propanoic acid |
| SMILES | CC(Nc1c(NC[C@H](O)[C@H](O)[C@H](O)CO)[nH]c(=O)[nH]c1=O)C(=O)O |
| InChI | InChI=1S/C12H20N4O8/c1-4(11(22)23)14-7-9(15-12(24)16-10(7)21)13-2-5(18)8(20)6(19)3-17/h4-6,8,14,17-20H,2-3H2,1H3,(H,22,23)(H3,13,15,16,21,24)/t4?,5-,6+,8-/m0/s1 |
| InChIKey | CTKKDWGFDUTOFX-FRBAZZNPSA-N |
| XLogP | -3.56 |
| TPSA | 208.00 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | -3.56 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 9 |