C24H17ClN2O3 — CID 101242890
(1R,3S)-3-(4-chlorophenyl)-1-(3-nitrophenyl)-2,3-dihydro-1H-benzo[f][1,3]benzoxazine (PubChem CID 101242890) has the molecular formula C24H17ClN2O3 and a molecular weight of 416.86 g/mol. Its IUPAC name is (1R,3S)-3-(4-chlorophenyl)-1-(3-nitrophenyl)-2,3-dihydro-1H-benzo[f][1,3]benzoxazine.
| Compound Name | (1R,3S)-3-(4-chlorophenyl)-1-(3-nitrophenyl)-2,3-dihydro-1H-benzo[f][1,3]benzoxazine |
|---|---|
| PubChem CID | 101242890 |
| Molecular Formula | C24H17ClN2O3 |
| Molecular Weight | 416.86 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | (1R,3S)-3-(4-chlorophenyl)-1-(3-nitrophenyl)-2,3-dihydro-1H-benzo[f][1,3]benzoxazine |
| SMILES | O=[N+]([O-])c1cccc([C@H]2N[C@H](c3ccc(Cl)cc3)Oc3ccc4ccccc4c32)c1 |
| InChI | InChI=1S/C24H17ClN2O3/c25-18-11-8-16(9-12-18)24-26-23(17-5-3-6-19(14-17)27(28)29)22-20-7-2-1-4-15(20)10-13-21(22)30-24/h1-14,23-24,26H/t23-,24+/m1/s1 |
| InChIKey | GYTNUHSCUGWICC-RPWUZVMVSA-N |
| XLogP | 6.17 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.86 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|