C25H20N2O3 — CID 11361455
(1S,3R)-3-(4-methylphenyl)-1-(4-nitrophenyl)-2,3-dihydro-1H-benzo[f][1,3]benzoxazine (PubChem CID 11361455) has the molecular formula C25H20N2O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is (1S,3R)-3-(4-methylphenyl)-1-(4-nitrophenyl)-2,3-dihydro-1H-benzo[f][1,3]benzoxazine.
| Compound Name | (1S,3R)-3-(4-methylphenyl)-1-(4-nitrophenyl)-2,3-dihydro-1H-benzo[f][1,3]benzoxazine |
|---|---|
| PubChem CID | 11361455 |
| Molecular Formula | C25H20N2O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | (1S,3R)-3-(4-methylphenyl)-1-(4-nitrophenyl)-2,3-dihydro-1H-benzo[f][1,3]benzoxazine |
| SMILES | Cc1ccc([C@@H]2N[C@@H](c3ccc([N+](=O)[O-])cc3)c3c(ccc4ccccc34)O2)cc1 |
| InChI | InChI=1S/C25H20N2O3/c1-16-6-8-19(9-7-16)25-26-24(18-10-13-20(14-11-18)27(28)29)23-21-5-3-2-4-17(21)12-15-22(23)30-25/h2-15,24-26H,1H3/t24-,25+/m0/s1 |
| InChIKey | VZPNMTPIWCOAAO-LOSJGSFVSA-N |
| XLogP | 5.83 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|