C23H27NO5S — CID 101246859
methyl 2-[1-(4-methylphenyl)sulfonyl-2-oxo-5-(3-phenylpropyl)pyrrolidin-3-yl]acetate (PubChem CID 101246859) has the molecular formula C23H27NO5S and a molecular weight of 429.54 g/mol. Its IUPAC name is methyl 2-[1-(4-methylphenyl)sulfonyl-2-oxo-5-(3-phenylpropyl)pyrrolidin-3-yl]acetate.
| Compound Name | methyl 2-[1-(4-methylphenyl)sulfonyl-2-oxo-5-(3-phenylpropyl)pyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 101246859 |
| Molecular Formula | C23H27NO5S |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.16 |
| IUPAC Name | methyl 2-[1-(4-methylphenyl)sulfonyl-2-oxo-5-(3-phenylpropyl)pyrrolidin-3-yl]acetate |
| SMILES | COC(=O)CC1CC(CCCc2ccccc2)N(S(=O)(=O)c2ccc(C)cc2)C1=O |
| InChI | InChI=1S/C23H27NO5S/c1-17-11-13-21(14-12-17)30(27,28)24-20(10-6-9-18-7-4-3-5-8-18)15-19(23(24)26)16-22(25)29-2/h3-5,7-8,11-14,19-20H,6,9-10,15-16H2,1-2H3 |
| InChIKey | ATCKRSCZAFZAMB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |