C14H9N3S — CID 10125275
3-[3-(1,3-thiazol-2-yl)pyrrol-1-yl]benzonitrile (PubChem CID 10125275) has the molecular formula C14H9N3S and a molecular weight of 251.31 g/mol. Its IUPAC name is 3-[3-(1,3-thiazol-2-yl)pyrrol-1-yl]benzonitrile.
| Compound Name | 3-[3-(1,3-thiazol-2-yl)pyrrol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 10125275 |
| Molecular Formula | C14H9N3S |
| Molecular Weight | 251.31 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 3-[3-(1,3-thiazol-2-yl)pyrrol-1-yl]benzonitrile |
| SMILES | N#Cc1cccc(-n2ccc(-c3nccs3)c2)c1 |
| InChI | InChI=1S/C14H9N3S/c15-9-11-2-1-3-13(8-11)17-6-4-12(10-17)14-16-5-7-18-14/h1-8,10H |
| InChIKey | BQPNZAYDYUUAKO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |