C10H8FN5O4 — CID 10125407
(2S,3R,5R)-5-(6-amino-2-fluoropurin-9-yl)-3-hydroxy-4-oxooxolane-2-carbaldehyde (PubChem CID 10125407) has the molecular formula C10H8FN5O4 and a molecular weight of 281.20 g/mol. Its IUPAC name is (2S,3R,5R)-5-(6-amino-2-fluoropurin-9-yl)-3-hydroxy-4-oxooxolane-2-carbaldehyde.
| Compound Name | (2S,3R,5R)-5-(6-amino-2-fluoropurin-9-yl)-3-hydroxy-4-oxooxolane-2-carbaldehyde |
|---|---|
| PubChem CID | 10125407 |
| Molecular Formula | C10H8FN5O4 |
| Molecular Weight | 281.20 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | (2S,3R,5R)-5-(6-amino-2-fluoropurin-9-yl)-3-hydroxy-4-oxooxolane-2-carbaldehyde |
| SMILES | Nc1nc(F)nc2c1ncn2[C@@H]1O[C@H](C=O)[C@@H](O)C1=O |
| InChI | InChI=1S/C10H8FN5O4/c11-10-14-7(12)4-8(15-10)16(2-13-4)9-6(19)5(18)3(1-17)20-9/h1-3,5,9,18H,(H2,12,14,15)/t3-,5-,9-/m1/s1 |
| InChIKey | TTXJPNLWORLSRS-IDGQQZLNSA-N |
| XLogP | -1.43 |
| TPSA | 133.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.20 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|