C18H27O8P — CID 101259401
[(3R,4R,5S,8S)-4-methyl-8-[(2S,3S)-3-methyl-6-oxo-2,3-dihydropyran-2-yl]-5-phosphonooxynon-1-yn-3-yl] acetate (PubChem CID 101259401) has the molecular formula C18H27O8P and a molecular weight of 402.38 g/mol. Its IUPAC name is [(3R,4R,5S,8S)-4-methyl-8-[(2S,3S)-3-methyl-6-oxo-2,3-dihydropyran-2-yl]-5-phosphonooxynon-1-yn-3-yl] acetate.
| Compound Name | [(3R,4R,5S,8S)-4-methyl-8-[(2S,3S)-3-methyl-6-oxo-2,3-dihydropyran-2-yl]-5-phosphonooxynon-1-yn-3-yl] acetate |
|---|---|
| PubChem CID | 101259401 |
| Molecular Formula | C18H27O8P |
| Molecular Weight | 402.38 g/mol |
| Exact Mass | 402.14 |
| IUPAC Name | [(3R,4R,5S,8S)-4-methyl-8-[(2S,3S)-3-methyl-6-oxo-2,3-dihydropyran-2-yl]-5-phosphonooxynon-1-yn-3-yl] acetate |
| SMILES | C#C[C@H](OC(C)=O)[C@@H](C)[C@H](CC[C@H](C)[C@@H]1OC(=O)C=C[C@@H]1C)OP(=O)(O)O |
| InChI | InChI=1S/C18H27O8P/c1-6-15(24-14(5)19)13(4)16(26-27(21,22)23)9-7-11(2)18-12(3)8-10-17(20)25-18/h1,8,10-13,15-16,18H,7,9H2,2-5H3,(H2,21,22,23)/t11-,12-,13+,15-,16-,18-/m0/s1 |
| InChIKey | MGCDTYHZUDUDHF-VRXMZMPVSA-N |
| XLogP | 2.20 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.38 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|