C19H23NO4Se — CID 101335194
(2R,3R,4R)-3-methyl-4-(2-nitrophenyl)selanyl-1-phenylmethoxypentan-2-ol (PubChem CID 101335194) has the molecular formula C19H23NO4Se and a molecular weight of 408.36 g/mol. Its IUPAC name is (2R,3R,4R)-3-methyl-4-(2-nitrophenyl)selanyl-1-phenylmethoxypentan-2-ol.
| Compound Name | (2R,3R,4R)-3-methyl-4-(2-nitrophenyl)selanyl-1-phenylmethoxypentan-2-ol |
|---|---|
| PubChem CID | 101335194 |
| Molecular Formula | C19H23NO4Se |
| Molecular Weight | 408.36 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | (2R,3R,4R)-3-methyl-4-(2-nitrophenyl)selanyl-1-phenylmethoxypentan-2-ol |
| SMILES | C[C@H]([C@@H](O)COCc1ccccc1)[C@@H](C)[Se]c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H23NO4Se/c1-14(18(21)13-24-12-16-8-4-3-5-9-16)15(2)25-19-11-7-6-10-17(19)20(22)23/h3-11,14-15,18,21H,12-13H2,1-2H3/t14-,15+,18-/m0/s1 |
| InChIKey | HBHRDCSWIGBBDL-DAYGRLMNSA-N |
| XLogP | 2.95 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.36 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|