C35H26N4O4 — CID 101336795
(6,20-dimethoxy-19-phenyldiazenyl-12,14-dioxapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3(8),4,6,9,16,18(23),19,21-decaen-7-yl)-phenyldiazene (PubChem CID 101336795) has the molecular formula C35H26N4O4 and a molecular weight of 566.62 g/mol. Its IUPAC name is (6,20-dimethoxy-19-phenyldiazenyl-12,14-dioxapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3(8),4,6,9,16,18(23),19,21-decaen-7-yl)-phenyldiazene.
| Compound Name | (6,20-dimethoxy-19-phenyldiazenyl-12,14-dioxapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3(8),4,6,9,16,18(23),19,21-decaen-7-yl)-phenyldiazene |
|---|---|
| PubChem CID | 101336795 |
| Molecular Formula | C35H26N4O4 |
| Molecular Weight | 566.62 g/mol |
| Exact Mass | 566.20 |
| IUPAC Name | (6,20-dimethoxy-19-phenyldiazenyl-12,14-dioxapentacyclo[13.8.0.02,11.03,8.018,23]tricosa-1(15),2(11),3(8),4,6,9,16,18(23),19,21-decaen-7-yl)-phenyldiazene |
| SMILES | COc1ccc2c3c(ccc2c1/N=N/c1ccccc1)OCOc1ccc2c(/N=N/c4ccccc4)c(OC)ccc2c1-3 |
| InChI | InChI=1S/C35H26N4O4/c1-40-30-19-13-24-26(34(30)38-36-22-9-5-3-6-10-22)15-17-28-32(24)33-25-14-20-31(41-2)35(39-37-23-11-7-4-8-12-23)27(25)16-18-29(33)43-21-42-28/h3-20H,21H2,1-2H3/b38-36+,39-37+ |
| InChIKey | KQUIBWJBTQAOQC-NFSGFYSESA-N |
| XLogP | 10.24 |
| TPSA | 86.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.62 |
| LogP ≤ 5 | 10.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|