C14H22F3N3O3 — CID 101340093
2-methyl-2-[(3S)-4-prop-2-enyl-3-(2,2,2-trifluoroethylcarbamoyl)piperazin-1-yl]propanoic acid (PubChem CID 101340093) has the molecular formula C14H22F3N3O3 and a molecular weight of 337.34 g/mol. Its IUPAC name is 2-methyl-2-[(3S)-4-prop-2-enyl-3-(2,2,2-trifluoroethylcarbamoyl)piperazin-1-yl]propanoic acid.
| Compound Name | 2-methyl-2-[(3S)-4-prop-2-enyl-3-(2,2,2-trifluoroethylcarbamoyl)piperazin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 101340093 |
| Molecular Formula | C14H22F3N3O3 |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 2-methyl-2-[(3S)-4-prop-2-enyl-3-(2,2,2-trifluoroethylcarbamoyl)piperazin-1-yl]propanoic acid |
| SMILES | C=CCN1CCN(C(C)(C)C(=O)O)C[C@H]1C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C14H22F3N3O3/c1-4-5-19-6-7-20(13(2,3)12(22)23)8-10(19)11(21)18-9-14(15,16)17/h4,10H,1,5-9H2,2-3H3,(H,18,21)(H,22,23)/t10-/m0/s1 |
| InChIKey | YHVOSPFPHGRSMU-JTQLQIEISA-N |
| XLogP | 0.70 |
| TPSA | 72.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|