C18H23NO3Si — CID 101341540
methyl 3-[dimethyl(phenyl)silyl]-3-[6-(hydroxymethyl)-3-pyridinyl]propanoate (PubChem CID 101341540) has the molecular formula C18H23NO3Si and a molecular weight of 329.47 g/mol. Its IUPAC name is methyl 3-[dimethyl(phenyl)silyl]-3-[6-(hydroxymethyl)-3-pyridinyl]propanoate.
| Compound Name | methyl 3-[dimethyl(phenyl)silyl]-3-[6-(hydroxymethyl)-3-pyridinyl]propanoate |
|---|---|
| PubChem CID | 101341540 |
| Molecular Formula | C18H23NO3Si |
| Molecular Weight | 329.47 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | methyl 3-[dimethyl(phenyl)silyl]-3-[6-(hydroxymethyl)-3-pyridinyl]propanoate |
| SMILES | COC(=O)CC(c1ccc(CO)nc1)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C18H23NO3Si/c1-22-18(21)11-17(14-9-10-15(13-20)19-12-14)23(2,3)16-7-5-4-6-8-16/h4-10,12,17,20H,11,13H2,1-3H3 |
| InChIKey | DFTYOBODASZUOM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.47 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|