C20H26O2S — CID 101354771
4-(benzenesulfinyl)-7-methyl-7b-propan-2-yl-2,3,4,4a,5,6-hexahydro-1aH-azuleno[4,5-b]oxirene (PubChem CID 101354771) has the molecular formula C20H26O2S and a molecular weight of 330.49 g/mol. Its IUPAC name is 4-(benzenesulfinyl)-7-methyl-7b-propan-2-yl-2,3,4,4a,5,6-hexahydro-1aH-azuleno[4,5-b]oxirene.
| Compound Name | 4-(benzenesulfinyl)-7-methyl-7b-propan-2-yl-2,3,4,4a,5,6-hexahydro-1aH-azuleno[4,5-b]oxirene |
|---|---|
| PubChem CID | 101354771 |
| Molecular Formula | C20H26O2S |
| Molecular Weight | 330.49 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 4-(benzenesulfinyl)-7-methyl-7b-propan-2-yl-2,3,4,4a,5,6-hexahydro-1aH-azuleno[4,5-b]oxirene |
| SMILES | CC1=C2C(CC1)C(S(=O)c1ccccc1)CCC1OC21C(C)C |
| InChI | InChI=1S/C20H26O2S/c1-13(2)20-18(22-20)12-11-17(16-10-9-14(3)19(16)20)23(21)15-7-5-4-6-8-15/h4-8,13,16-18H,9-12H2,1-3H3 |
| InChIKey | JMNIRZFOXYVRRU-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|