C12H21N2O3+ — CID 101362797
16-methyl-4,7,10-trioxa-13-aza-1-azoniabicyclo[11.2.1]hexadeca-1(16),14-diene (PubChem CID 101362797) has the molecular formula C12H21N2O3+ and a molecular weight of 241.31 g/mol. Its IUPAC name is 16-methyl-4,7,10-trioxa-13-aza-1-azoniabicyclo[11.2.1]hexadeca-1(16),14-diene.
| Compound Name | 16-methyl-4,7,10-trioxa-13-aza-1-azoniabicyclo[11.2.1]hexadeca-1(16),14-diene |
|---|---|
| PubChem CID | 101362797 |
| Molecular Formula | C12H21N2O3+ |
| Molecular Weight | 241.31 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 16-methyl-4,7,10-trioxa-13-aza-1-azoniabicyclo[11.2.1]hexadeca-1(16),14-diene |
| SMILES | Cc1n2cc[n+]1CCOCCOCCOCC2 |
| InChI | InChI=1S/C12H21N2O3/c1-12-13-2-3-14(12)5-7-16-9-11-17-10-8-15-6-4-13/h2-3H,4-11H2,1H3/q+1 |
| InChIKey | ZMGCWXBEJNFNOH-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 36.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.31 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|