C34H50N4O8+2 — CID 11412067
4,7,10,13,26,29,32,35-octaoxa-16,38-diaza-1,23-diazoniapentacyclo[36.6.1.116,23.017,22.039,44]hexatetraconta-1(45),17,19,21,23(46),39,41,43-octaene (PubChem CID 11412067) has the molecular formula C34H50N4O8+2 and a molecular weight of 642.79 g/mol. Its IUPAC name is 4,7,10,13,26,29,32,35-octaoxa-16,38-diaza-1,23-diazoniapentacyclo[36.6.1.116,23.017,22.039,44]hexatetraconta-1(45),17,19,21,23(46),39,41,43-octaene.
| Compound Name | 4,7,10,13,26,29,32,35-octaoxa-16,38-diaza-1,23-diazoniapentacyclo[36.6.1.116,23.017,22.039,44]hexatetraconta-1(45),17,19,21,23(46),39,41,43-octaene |
|---|---|
| PubChem CID | 11412067 |
| Molecular Formula | C34H50N4O8+2 |
| Molecular Weight | 642.79 g/mol |
| Exact Mass | 642.36 |
| IUPAC Name | 4,7,10,13,26,29,32,35-octaoxa-16,38-diaza-1,23-diazoniapentacyclo[36.6.1.116,23.017,22.039,44]hexatetraconta-1(45),17,19,21,23(46),39,41,43-octaene |
| SMILES | c1ccc2c(c1)n1c[n+]2CCOCCOCCOCCOCCn2c[n+](c3ccccc32)CCOCCOCCOCCOCC1 |
| InChI | InChI=1S/C34H50N4O8/c1-2-6-32-31(5-1)35-9-13-39-17-21-43-25-26-45-23-19-41-15-11-37-30-38(34-8-4-3-7-33(34)37)12-16-42-20-24-46-28-27-44-22-18-40-14-10-36(32)29-35/h1-8,29-30H,9-28H2/q+2 |
| InChIKey | AIYQSRAMMUSBAI-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 91.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.79 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|