C25H25Cl2N5O — CID 10939788
19-oxa-16,22,31-triaza-1,9-diazoniahexacyclo[20.6.1.13,7.19,16.010,15.023,28]hentriaconta-1(29),3(31),4,6,9(30),10,12,14,23,25,27-undecaene dichloride (PubChem CID 10939788) has the molecular formula C25H25Cl2N5O and a molecular weight of 482.42 g/mol. Its IUPAC name is 19-oxa-16,22,31-triaza-1,9-diazoniahexacyclo[20.6.1.13,7.19,16.010,15.023,28]hentriaconta-1(29),3(31),4,6,9(30),10,12,14,23,25,27-undecaene dichloride.
| Compound Name | 19-oxa-16,22,31-triaza-1,9-diazoniahexacyclo[20.6.1.13,7.19,16.010,15.023,28]hentriaconta-1(29),3(31),4,6,9(30),10,12,14,23,25,27-undecaene dichloride |
|---|---|
| PubChem CID | 10939788 |
| Molecular Formula | C25H25Cl2N5O |
| Molecular Weight | 482.42 g/mol |
| Exact Mass | 481.14 |
| IUPAC Name | 19-oxa-16,22,31-triaza-1,9-diazoniahexacyclo[20.6.1.13,7.19,16.010,15.023,28]hentriaconta-1(29),3(31),4,6,9(30),10,12,14,23,25,27-undecaene dichloride |
| SMILES | [Cl-].[Cl-].c1cc2nc(c1)C[n+]1cn(c3ccccc31)CCOCCn1c[n+](c3ccccc31)C2 |
| InChI | InChI=1S/C25H25N5O.2ClH/c1-3-10-24-22(8-1)27-12-14-31-15-13-28-19-30(25-11-4-2-9-23(25)28)17-21-7-5-6-20(26-21)16-29(24)18-27;;/h1-11,18-19H,12-17H2;2*1H/q+2;;/p-2 |
| InChIKey | PEDSKPGBRPVSPM-UHFFFAOYSA-L |
| XLogP | -3.30 |
| TPSA | 39.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.42 |
| LogP ≤ 5 | -3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|