C27H28Br2N4O2 — CID 11028381
31-methoxy-19-oxa-16,22-diaza-1,9-diazoniahexacyclo[20.6.1.13,7.19,16.010,15.023,28]hentriaconta-1(29),3(31),4,6,9(30),10,12,14,23,25,27-undecaene dibromide (PubChem CID 11028381) has the molecular formula C27H28Br2N4O2 and a molecular weight of 600.36 g/mol. Its IUPAC name is 31-methoxy-19-oxa-16,22-diaza-1,9-diazoniahexacyclo[20.6.1.13,7.19,16.010,15.023,28]hentriaconta-1(29),3(31),4,6,9(30),10,12,14,23,25,27-undecaene dibromide.
| Compound Name | 31-methoxy-19-oxa-16,22-diaza-1,9-diazoniahexacyclo[20.6.1.13,7.19,16.010,15.023,28]hentriaconta-1(29),3(31),4,6,9(30),10,12,14,23,25,27-undecaene dibromide |
|---|---|
| PubChem CID | 11028381 |
| Molecular Formula | C27H28Br2N4O2 |
| Molecular Weight | 600.36 g/mol |
| Exact Mass | 598.06 |
| IUPAC Name | 31-methoxy-19-oxa-16,22-diaza-1,9-diazoniahexacyclo[20.6.1.13,7.19,16.010,15.023,28]hentriaconta-1(29),3(31),4,6,9(30),10,12,14,23,25,27-undecaene dibromide |
| SMILES | COc1c2cccc1C[n+]1cn(c3ccccc31)CCOCCn1c[n+](c3ccccc31)C2.[Br-].[Br-] |
| InChI | InChI=1S/C27H28N4O2.2BrH/c1-32-27-21-7-6-8-22(27)18-31-20-29(24-10-3-5-12-26(24)31)14-16-33-15-13-28-19-30(17-21)25-11-4-2-9-23(25)28;;/h2-12,19-20H,13-18H2,1H3;2*1H/q+2;;/p-2 |
| InChIKey | VGDXQQZMMGMGFG-UHFFFAOYSA-L |
| XLogP | -2.69 |
| TPSA | 36.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.36 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|