C27H30NOP — CID 101365751
diphenyl-[[(1R,2R,4S)-1,3,3-trimethyl-2-pyridin-2-yl-2-bicyclo[2.2.1]heptanyl]oxy]phosphane (PubChem CID 101365751) has the molecular formula C27H30NOP and a molecular weight of 415.52 g/mol. Its IUPAC name is diphenyl-[[(1R,2R,4S)-1,3,3-trimethyl-2-pyridin-2-yl-2-bicyclo[2.2.1]heptanyl]oxy]phosphane.
| Compound Name | diphenyl-[[(1R,2R,4S)-1,3,3-trimethyl-2-pyridin-2-yl-2-bicyclo[2.2.1]heptanyl]oxy]phosphane |
|---|---|
| PubChem CID | 101365751 |
| Molecular Formula | C27H30NOP |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | diphenyl-[[(1R,2R,4S)-1,3,3-trimethyl-2-pyridin-2-yl-2-bicyclo[2.2.1]heptanyl]oxy]phosphane |
| SMILES | CC1(C)[C@H]2CC[C@](C)(C2)[C@]1(OP(c1ccccc1)c1ccccc1)c1ccccn1 |
| InChI | InChI=1S/C27H30NOP/c1-25(2)21-17-18-26(3,20-21)27(25,24-16-10-11-19-28-24)29-30(22-12-6-4-7-13-22)23-14-8-5-9-15-23/h4-16,19,21H,17-18,20H2,1-3H3/t21-,26+,27-/m0/s1 |
| InChIKey | JCVJGNUQIJDZCR-KWTBFXGESA-N |
| XLogP | 6.19 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|