C11H15F3O3 — CID 101370700
ethyl (2R)-2-(cyclopenten-1-ylmethyl)-3,3,3-trifluoro-2-hydroxypropanoate (PubChem CID 101370700) has the molecular formula C11H15F3O3 and a molecular weight of 252.23 g/mol. Its IUPAC name is ethyl (2R)-2-(cyclopenten-1-ylmethyl)-3,3,3-trifluoro-2-hydroxypropanoate.
| Compound Name | ethyl (2R)-2-(cyclopenten-1-ylmethyl)-3,3,3-trifluoro-2-hydroxypropanoate |
|---|---|
| PubChem CID | 101370700 |
| Molecular Formula | C11H15F3O3 |
| Molecular Weight | 252.23 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | ethyl (2R)-2-(cyclopenten-1-ylmethyl)-3,3,3-trifluoro-2-hydroxypropanoate |
| SMILES | CCOC(=O)[C@](O)(CC1=CCCC1)C(F)(F)F |
| InChI | InChI=1S/C11H15F3O3/c1-2-17-9(15)10(16,11(12,13)14)7-8-5-3-4-6-8/h5,16H,2-4,6-7H2,1H3/t10-/m1/s1 |
| InChIKey | MXOBHKBHJAEDJP-SNVBAGLBSA-N |
| XLogP | 2.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.23 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|