C18H16O4 — CID 101370738
(1S,2S,6R,7R)-1-methyl-4-phenylspiro[10-oxatricyclo[5.2.1.02,6]decane-9,1'-cyclopropane]-3,5,8-trione (PubChem CID 101370738) has the molecular formula C18H16O4 and a molecular weight of 296.32 g/mol. Its IUPAC name is (1S,2S,6R,7R)-1-methyl-4-phenylspiro[10-oxatricyclo[5.2.1.02,6]decane-9,1'-cyclopropane]-3,5,8-trione.
| Compound Name | (1S,2S,6R,7R)-1-methyl-4-phenylspiro[10-oxatricyclo[5.2.1.02,6]decane-9,1'-cyclopropane]-3,5,8-trione |
|---|---|
| PubChem CID | 101370738 |
| Molecular Formula | C18H16O4 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | (1S,2S,6R,7R)-1-methyl-4-phenylspiro[10-oxatricyclo[5.2.1.02,6]decane-9,1'-cyclopropane]-3,5,8-trione |
| SMILES | C[C@@]12O[C@@H](C(=O)C13CC3)[C@@H]1C(=O)C(c3ccccc3)C(=O)[C@@H]12 |
| InChI | InChI=1S/C18H16O4/c1-17-12-11(15(22-17)16(21)18(17)7-8-18)13(19)10(14(12)20)9-5-3-2-4-6-9/h2-6,10-12,15H,7-8H2,1H3/t10?,11-,12+,15+,17-/m0/s1 |
| InChIKey | UJNHOOBEPMGKQA-BUAIHESLSA-N |
| XLogP | 1.67 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|