C30H26O2 — CID 101372725
(2S,6R,8S,9Z)-2,5,8-trimethyl-4,10-diphenyltricyclo[9.4.0.02,6]pentadeca-1(15),4,9,11,13-pentaene-3,7-dione (PubChem CID 101372725) has the molecular formula C30H26O2 and a molecular weight of 418.54 g/mol. Its IUPAC name is (2S,6R,8S,9Z)-2,5,8-trimethyl-4,10-diphenyltricyclo[9.4.0.02,6]pentadeca-1(15),4,9,11,13-pentaene-3,7-dione.
| Compound Name | (2S,6R,8S,9Z)-2,5,8-trimethyl-4,10-diphenyltricyclo[9.4.0.02,6]pentadeca-1(15),4,9,11,13-pentaene-3,7-dione |
|---|---|
| PubChem CID | 101372725 |
| Molecular Formula | C30H26O2 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | (2S,6R,8S,9Z)-2,5,8-trimethyl-4,10-diphenyltricyclo[9.4.0.02,6]pentadeca-1(15),4,9,11,13-pentaene-3,7-dione |
| SMILES | CC1=C(c2ccccc2)C(=O)[C@]2(C)c3ccccc3/C(c3ccccc3)=C\[C@H](C)C(=O)[C@H]12 |
| InChI | InChI=1S/C30H26O2/c1-19-18-24(21-12-6-4-7-13-21)23-16-10-11-17-25(23)30(3)27(28(19)31)20(2)26(29(30)32)22-14-8-5-9-15-22/h4-19,27H,1-3H3/b24-18-/t19-,27-,30+/m0/s1 |
| InChIKey | VQDULHDGVCYYNS-QVSSPEDSSA-N |
| XLogP | 6.27 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |