C15H18N2O3 — CID 101372966
N-[(3aS,4R,7aS)-2-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]-N-methylpent-2-ynamide (PubChem CID 101372966) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is N-[(3aS,4R,7aS)-2-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]-N-methylpent-2-ynamide.
| Compound Name | N-[(3aS,4R,7aS)-2-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]-N-methylpent-2-ynamide |
|---|---|
| PubChem CID | 101372966 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | N-[(3aS,4R,7aS)-2-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl]-N-methylpent-2-ynamide |
| SMILES | CCC#CC(=O)N(C)[C@@H]1C=CC[C@@H]2C(=O)N(C)C(=O)[C@@H]21 |
| InChI | InChI=1S/C15H18N2O3/c1-4-5-9-12(18)16(2)11-8-6-7-10-13(11)15(20)17(3)14(10)19/h6,8,10-11,13H,4,7H2,1-3H3/t10-,11+,13-/m0/s1 |
| InChIKey | ZWQLWJWIJSSSRN-LOWVWBTDSA-N |
| XLogP | 0.42 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|