C12H17NO5P- — CID 20726578
methyl-[2-(2-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl)ethoxy]phosphinate (PubChem CID 20726578) has the molecular formula C12H17NO5P- and a molecular weight of 286.24 g/mol. Its IUPAC name is methyl-[2-(2-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl)ethoxy]phosphinate.
| Compound Name | methyl-[2-(2-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl)ethoxy]phosphinate |
|---|---|
| PubChem CID | 20726578 |
| Molecular Formula | C12H17NO5P- |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | methyl-[2-(2-methyl-1,3-dioxo-3a,4,7,7a-tetrahydroisoindol-4-yl)ethoxy]phosphinate |
| SMILES | CN1C(=O)C2CC=CC(CCOP(C)(=O)[O-])C2C1=O |
| InChI | InChI=1S/C12H18NO5P/c1-13-11(14)9-5-3-4-8(10(9)12(13)15)6-7-18-19(2,16)17/h3-4,8-10H,5-7H2,1-2H3,(H,16,17)/p-1 |
| InChIKey | WKNLEDNBPDPOMY-UHFFFAOYSA-M |
| XLogP | 0.38 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|