C18H15Cl3N2O — CID 101373189
N-benzyl-2,2,2-trichloro-N-(1H-indol-3-ylmethyl)acetamide (PubChem CID 101373189) has the molecular formula C18H15Cl3N2O and a molecular weight of 381.69 g/mol. Its IUPAC name is N-benzyl-2,2,2-trichloro-N-(1H-indol-3-ylmethyl)acetamide.
| Compound Name | N-benzyl-2,2,2-trichloro-N-(1H-indol-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 101373189 |
| Molecular Formula | C18H15Cl3N2O |
| Molecular Weight | 381.69 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | N-benzyl-2,2,2-trichloro-N-(1H-indol-3-ylmethyl)acetamide |
| SMILES | O=C(N(Cc1ccccc1)Cc1c[nH]c2ccccc12)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H15Cl3N2O/c19-18(20,21)17(24)23(11-13-6-2-1-3-7-13)12-14-10-22-16-9-5-4-8-15(14)16/h1-10,22H,11-12H2 |
| InChIKey | CZKKXGQCAVHGJD-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.69 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|