C24H39NO4Si — CID 101374554
(1R,5S,8S,9S)-2-benzyl-8-[[tert-butyl(dimethyl)silyl]oxymethyl]spiro[3,7-dioxa-2-azabicyclo[3.3.1]nonane-6,1'-cyclopentane]-9-ol (PubChem CID 101374554) has the molecular formula C24H39NO4Si and a molecular weight of 433.67 g/mol. Its IUPAC name is (1R,5S,8S,9S)-2-benzyl-8-[[tert-butyl(dimethyl)silyl]oxymethyl]spiro[3,7-dioxa-2-azabicyclo[3.3.1]nonane-6,1'-cyclopentane]-9-ol.
| Compound Name | (1R,5S,8S,9S)-2-benzyl-8-[[tert-butyl(dimethyl)silyl]oxymethyl]spiro[3,7-dioxa-2-azabicyclo[3.3.1]nonane-6,1'-cyclopentane]-9-ol |
|---|---|
| PubChem CID | 101374554 |
| Molecular Formula | C24H39NO4Si |
| Molecular Weight | 433.67 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | (1R,5S,8S,9S)-2-benzyl-8-[[tert-butyl(dimethyl)silyl]oxymethyl]spiro[3,7-dioxa-2-azabicyclo[3.3.1]nonane-6,1'-cyclopentane]-9-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1OC2(CCCC2)[C@H]2CON(Cc3ccccc3)[C@@H]1[C@H]2O |
| InChI | InChI=1S/C24H39NO4Si/c1-23(2,3)30(4,5)28-17-20-21-22(26)19(24(29-20)13-9-10-14-24)16-27-25(21)15-18-11-7-6-8-12-18/h6-8,11-12,19-22,26H,9-10,13-17H2,1-5H3/t19-,20+,21-,22-/m0/s1 |
| InChIKey | RDSHINXQSNCOLO-LRSLUSHPSA-N |
| XLogP | 4.51 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.67 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|