C25H41NO4Si — CID 101374555
(1R,5S,8S,9S)-2-benzyl-8-[[tert-butyl(dimethyl)silyl]oxymethyl]spiro[3,7-dioxa-2-azabicyclo[3.3.1]nonane-6,1'-cyclohexane]-9-ol (PubChem CID 101374555) has the molecular formula C25H41NO4Si and a molecular weight of 447.69 g/mol. Its IUPAC name is (1R,5S,8S,9S)-2-benzyl-8-[[tert-butyl(dimethyl)silyl]oxymethyl]spiro[3,7-dioxa-2-azabicyclo[3.3.1]nonane-6,1'-cyclohexane]-9-ol.
| Compound Name | (1R,5S,8S,9S)-2-benzyl-8-[[tert-butyl(dimethyl)silyl]oxymethyl]spiro[3,7-dioxa-2-azabicyclo[3.3.1]nonane-6,1'-cyclohexane]-9-ol |
|---|---|
| PubChem CID | 101374555 |
| Molecular Formula | C25H41NO4Si |
| Molecular Weight | 447.69 g/mol |
| Exact Mass | 447.28 |
| IUPAC Name | (1R,5S,8S,9S)-2-benzyl-8-[[tert-butyl(dimethyl)silyl]oxymethyl]spiro[3,7-dioxa-2-azabicyclo[3.3.1]nonane-6,1'-cyclohexane]-9-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1OC2(CCCCC2)[C@H]2CON(Cc3ccccc3)[C@@H]1[C@H]2O |
| InChI | InChI=1S/C25H41NO4Si/c1-24(2,3)31(4,5)29-18-21-22-23(27)20(25(30-21)14-10-7-11-15-25)17-28-26(22)16-19-12-8-6-9-13-19/h6,8-9,12-13,20-23,27H,7,10-11,14-18H2,1-5H3/t20-,21+,22-,23-/m0/s1 |
| InChIKey | ZNSUTXZPWHDXLI-BJESRGMDSA-N |
| XLogP | 4.90 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.69 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|