C27H55NSi5 — CID 101375019
N-(1-adamantyl)-1-[2,2,5,5-tetrakis(trimethylsilyl)silolan-1-ylidene]methanimine (PubChem CID 101375019) has the molecular formula C27H55NSi5 and a molecular weight of 534.17 g/mol. Its IUPAC name is N-(1-adamantyl)-1-[2,2,5,5-tetrakis(trimethylsilyl)silolan-1-ylidene]methanimine.
| Compound Name | N-(1-adamantyl)-1-[2,2,5,5-tetrakis(trimethylsilyl)silolan-1-ylidene]methanimine |
|---|---|
| PubChem CID | 101375019 |
| Molecular Formula | C27H55NSi5 |
| Molecular Weight | 534.17 g/mol |
| Exact Mass | 533.32 |
| IUPAC Name | N-(1-adamantyl)-1-[2,2,5,5-tetrakis(trimethylsilyl)silolan-1-ylidene]methanimine |
| SMILES | C[Si](C)(C)C1([Si](C)(C)C)CCC([Si](C)(C)C)([Si](C)(C)C)[Si]1=C=NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C27H55NSi5/c1-30(2,3)26(31(4,5)6)13-14-27(32(7,8)9,33(10,11)12)29(26)21-28-25-18-22-15-23(19-25)17-24(16-22)20-25/h22-24H,13-20H2,1-12H3 |
| InChIKey | CLSBXVURKBWMOU-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.17 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|