About methane;2-sulfidobenzoate;tin(2+)
methane;2-sulfidobenzoate;tin(2+) (PubChem CID 101376213) has the molecular formula C9H12O2SSn
and a molecular weight of 302.97 g/mol. Its IUPAC name is methane;2-sulfidobenzoate;tin(2+).
Molecular Properties
| Compound Name | methane;2-sulfidobenzoate;tin(2+) |
| PubChem CID | 101376213 |
| Molecular Formula | C9H12O2SSn |
| Molecular Weight | 302.97 g/mol |
| Exact Mass | 303.96 |
| IUPAC Name | methane;2-sulfidobenzoate;tin(2+) |
| SMILES | C.C.O=C([O-])c1ccccc1[S-].[Sn+2] |
| InChI | InChI=1S/C7H6O2S.2CH4.Sn/c8-7(9)5-3-1-2-4-6(5)10;;;/h1-4,10H,(H,8,9);2*1H4;/q;;;+2/p-2 |
| InChIKey | JHDVURGHNVGFNL-UHFFFAOYSA-L |
| XLogP | 0.85 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.97 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze methane;2-sulfidobenzoate;tin(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-sulfidobenzoate;tin(2+)?
The IUPAC name of methane;2-sulfidobenzoate;tin(2+) (CID 101376213) is methane;2-sulfidobenzoate;tin(2+).
What is the SMILES notation for methane;2-sulfidobenzoate;tin(2+)?
The canonical SMILES for methane;2-sulfidobenzoate;tin(2+) is C.C.O=C([O-])c1ccccc1[S-].[Sn+2].
What is the InChIKey of methane;2-sulfidobenzoate;tin(2+)?
The InChIKey is JHDVURGHNVGFNL-UHFFFAOYSA-L. The full InChI is InChI=1S/C7H6O2S.2CH4.Sn/c8-7(9)5-3-1-2-4-6(5)10;;;/h1-4,10H,(H,8,9);2*1H4;/q;;;+2/p-2.
What are the key properties of methane;2-sulfidobenzoate;tin(2+)?
methane;2-sulfidobenzoate;tin(2+) has a molecular weight of 302.97 g/mol, XLogP of 0.85, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-sulfidobenzoate;tin(2+) is sourced from PubChem (CID 101376213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).