C19H14F6N2O3 — CID 10137647
2-[4-[5-amino-3-(4-methoxyphenyl)-1,2-oxazol-4-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 10137647) has the molecular formula C19H14F6N2O3 and a molecular weight of 432.32 g/mol. Its IUPAC name is 2-[4-[5-amino-3-(4-methoxyphenyl)-1,2-oxazol-4-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4-[5-amino-3-(4-methoxyphenyl)-1,2-oxazol-4-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 10137647 |
| Molecular Formula | C19H14F6N2O3 |
| Molecular Weight | 432.32 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | 2-[4-[5-amino-3-(4-methoxyphenyl)-1,2-oxazol-4-yl]phenyl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | COc1ccc(-c2noc(N)c2-c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C19H14F6N2O3/c1-29-13-8-4-11(5-9-13)15-14(16(26)30-27-15)10-2-6-12(7-3-10)17(28,18(20,21)22)19(23,24)25/h2-9,28H,26H2,1H3 |
| InChIKey | BRQVWDYNTPKSDT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.32 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |