C26H36N2O14 — CID 101377357
bis[2-[2-[1-(2-methylprop-2-enoylamino)propan-2-yloxy]-2-oxoethoxy]-2-oxoethyl] butanedioate (PubChem CID 101377357) has the molecular formula C26H36N2O14 and a molecular weight of 600.57 g/mol. Its IUPAC name is bis[2-[2-[1-(2-methylprop-2-enoylamino)propan-2-yloxy]-2-oxoethoxy]-2-oxoethyl] butanedioate.
| Compound Name | bis[2-[2-[1-(2-methylprop-2-enoylamino)propan-2-yloxy]-2-oxoethoxy]-2-oxoethyl] butanedioate |
|---|---|
| PubChem CID | 101377357 |
| Molecular Formula | C26H36N2O14 |
| Molecular Weight | 600.57 g/mol |
| Exact Mass | 600.22 |
| IUPAC Name | bis[2-[2-[1-(2-methylprop-2-enoylamino)propan-2-yloxy]-2-oxoethoxy]-2-oxoethyl] butanedioate |
| SMILES | C=C(C)C(=O)NCC(C)OC(=O)COC(=O)COC(=O)CCC(=O)OCC(=O)OCC(=O)OC(C)CNC(=O)C(=C)C |
| InChI | InChI=1S/C26H36N2O14/c1-15(2)25(35)27-9-17(5)41-23(33)13-39-21(31)11-37-19(29)7-8-20(30)38-12-22(32)40-14-24(34)42-18(6)10-28-26(36)16(3)4/h17-18H,1,3,7-14H2,2,4-6H3,(H,27,35)(H,28,36) |
| InChIKey | YASNTANVRPJPTR-UHFFFAOYSA-N |
| XLogP | -0.81 |
| TPSA | 216.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.57 |
| LogP ≤ 5 | -0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|