C33H42O2S2 — CID 101381147
2-[2-[4-(benzenesulfonylmethyl)-2,5-diheptylphenyl]ethynyl]thiophene (PubChem CID 101381147) has the molecular formula C33H42O2S2 and a molecular weight of 534.83 g/mol. Its IUPAC name is 2-[2-[4-(benzenesulfonylmethyl)-2,5-diheptylphenyl]ethynyl]thiophene.
| Compound Name | 2-[2-[4-(benzenesulfonylmethyl)-2,5-diheptylphenyl]ethynyl]thiophene |
|---|---|
| PubChem CID | 101381147 |
| Molecular Formula | C33H42O2S2 |
| Molecular Weight | 534.83 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | 2-[2-[4-(benzenesulfonylmethyl)-2,5-diheptylphenyl]ethynyl]thiophene |
| SMILES | CCCCCCCc1cc(CS(=O)(=O)c2ccccc2)c(CCCCCCC)cc1C#Cc1cccs1 |
| InChI | InChI=1S/C33H42O2S2/c1-3-5-7-9-12-17-28-26-31(27-37(34,35)33-20-14-11-15-21-33)29(18-13-10-8-6-4-2)25-30(28)22-23-32-19-16-24-36-32/h11,14-16,19-21,24-26H,3-10,12-13,17-18,27H2,1-2H3 |
| InChIKey | ULJKIJZEWDBPBQ-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.83 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|