C17H20O3 — CID 101386923
(2R,4S,5S,6R,7S,10R)-6-(phenylmethoxymethyl)-9-oxatetracyclo[5.3.0.01,5.02,4]decan-10-ol (PubChem CID 101386923) has the molecular formula C17H20O3 and a molecular weight of 272.34 g/mol. Its IUPAC name is (2R,4S,5S,6R,7S,10R)-6-(phenylmethoxymethyl)-9-oxatetracyclo[5.3.0.01,5.02,4]decan-10-ol.
| Compound Name | (2R,4S,5S,6R,7S,10R)-6-(phenylmethoxymethyl)-9-oxatetracyclo[5.3.0.01,5.02,4]decan-10-ol |
|---|---|
| PubChem CID | 101386923 |
| Molecular Formula | C17H20O3 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | (2R,4S,5S,6R,7S,10R)-6-(phenylmethoxymethyl)-9-oxatetracyclo[5.3.0.01,5.02,4]decan-10-ol |
| SMILES | O[C@@H]1OC[C@H]2[C@H](COCc3ccccc3)[C@@H]3[C@H]4CC4C312 |
| InChI | InChI=1S/C17H20O3/c18-16-17-13-6-11(13)15(17)12(14(17)9-20-16)8-19-7-10-4-2-1-3-5-10/h1-5,11-16,18H,6-9H2/t11-,12-,13?,14-,15-,16+,17?/m0/s1 |
| InChIKey | QOKWSBNAKRPRHH-CIQSQARJSA-N |
| XLogP | 2.05 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |