C46H41OPS2Si2 — CID 101390796
2,2-diphenylethenyl-[10-[2,2-diphenylethenyl(dimethyl)silyl]-7-oxo-7-phenyl-3,11-dithia-7λ5-phosphatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-dimethylsilane (PubChem CID 101390796) has the molecular formula C46H41OPS2Si2 and a molecular weight of 761.11 g/mol. Its IUPAC name is 2,2-diphenylethenyl-[10-[2,2-diphenylethenyl(dimethyl)silyl]-7-oxo-7-phenyl-3,11-dithia-7λ5-phosphatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-dimethylsilane.
| Compound Name | 2,2-diphenylethenyl-[10-[2,2-diphenylethenyl(dimethyl)silyl]-7-oxo-7-phenyl-3,11-dithia-7λ5-phosphatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-dimethylsilane |
|---|---|
| PubChem CID | 101390796 |
| Molecular Formula | C46H41OPS2Si2 |
| Molecular Weight | 761.11 g/mol |
| Exact Mass | 760.19 |
| IUPAC Name | 2,2-diphenylethenyl-[10-[2,2-diphenylethenyl(dimethyl)silyl]-7-oxo-7-phenyl-3,11-dithia-7λ5-phosphatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-dimethylsilane |
| SMILES | C[Si](C)(C=C(c1ccccc1)c1ccccc1)c1cc2c(s1)-c1sc([Si](C)(C)C=C(c3ccccc3)c3ccccc3)cc1P2(=O)c1ccccc1 |
| InChI | InChI=1S/C46H41OPS2Si2/c1-51(2,32-39(34-20-10-5-11-21-34)35-22-12-6-13-23-35)43-30-41-45(49-43)46-42(48(41,47)38-28-18-9-19-29-38)31-44(50-46)52(3,4)33-40(36-24-14-7-15-25-36)37-26-16-8-17-27-37/h5-33H,1-4H3 |
| InChIKey | HCMUZELXAGNANH-UHFFFAOYSA-N |
| XLogP | 10.60 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.11 |
| LogP ≤ 5 | 10.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|